About 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol
2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol (PubChem CID 65208612) has the molecular formula C7H13N3OS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol.
Analyze 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
The IUPAC name of 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol (CID 65208612) is 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol.
What is the SMILES notation for 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
The canonical SMILES for 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol is CCN(CCO)c1nnc(C)s1.
What is the InChIKey of 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
The InChIKey is ORUGEYNPUWQZQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3OS/c1-3-10(4-5-11)7-9-8-6(2)12-7/h11H,3-5H2,1-2H3.
What are the key properties of 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol?
2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol has a molecular weight of 187.27 g/mol, XLogP of 0.67, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[ethyl-(5-methyl-1,3,4-thiadiazol-2-yl)amino]ethanol is sourced from PubChem (CID 65208612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).