C9H14F3N3O2S — CID 114263321
2-[2-[ethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]ethoxy]ethanol (PubChem CID 114263321) has the molecular formula C9H14F3N3O2S and a molecular weight of 285.29 g/mol. Its IUPAC name is 2-[2-[ethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]ethoxy]ethanol.
| Compound Name | 2-[2-[ethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]ethoxy]ethanol |
|---|---|
| PubChem CID | 114263321 |
| Molecular Formula | C9H14F3N3O2S |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-[2-[ethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]ethoxy]ethanol |
| SMILES | CCN(CCOCCO)c1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H14F3N3O2S/c1-2-15(3-5-17-6-4-16)8-14-13-7(18-8)9(10,11)12/h16H,2-6H2,1H3 |
| InChIKey | WNGVDZXLOPZHLM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|