C9H13F3N4OS2 — CID 114449547
3-[2-methoxyethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanethioamide (PubChem CID 114449547) has the molecular formula C9H13F3N4OS2 and a molecular weight of 314.36 g/mol. Its IUPAC name is 3-[2-methoxyethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanethioamide.
| Compound Name | 3-[2-methoxyethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanethioamide |
|---|---|
| PubChem CID | 114449547 |
| Molecular Formula | C9H13F3N4OS2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 3-[2-methoxyethyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanethioamide |
| SMILES | COCCN(CCC(N)=S)c1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H13F3N4OS2/c1-17-5-4-16(3-2-6(13)18)8-15-14-7(19-8)9(10,11)12/h2-5H2,1H3,(H2,13,18) |
| InChIKey | DVJFOQJNNBBLIH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|