C11H20N4O2S — CID 65169157
3-[(4,5-dimethyl-1,3-thiazol-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide (PubChem CID 65169157) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 3-[(4,5-dimethyl-1,3-thiazol-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide.
| Compound Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 65169157 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-[(4,5-dimethyl-1,3-thiazol-2-yl)-(2-methoxyethyl)amino]-N'-hydroxypropanimidamide |
| SMILES | COCCN(CC/C(N)=N/O)c1nc(C)c(C)s1 |
| InChI | InChI=1S/C11H20N4O2S/c1-8-9(2)18-11(13-8)15(6-7-17-3)5-4-10(12)14-16/h16H,4-7H2,1-3H3,(H2,12,14) |
| InChIKey | QHPBHFCZFUMMCZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|