About 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane
4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane (PubChem CID 142273119) has the molecular formula C15H31N3OS
and a molecular weight of 301.50 g/mol. Its IUPAC name is 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane.
Molecular Properties
| Compound Name | 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane |
| PubChem CID | 142273119 |
| Molecular Formula | C15H31N3OS |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane |
| SMILES | CC.CC.Cc1nc(NCCN2CCOCC2)sc1C |
| InChI | InChI=1S/C11H19N3OS.2C2H6/c1-9-10(2)16-11(13-9)12-3-4-14-5-7-15-8-6-14;2*1-2/h3-8H2,1-2H3,(H,12,13);2*1-2H3 |
| InChIKey | QFFDLXPZPGKQFP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane?
The IUPAC name of 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane (CID 142273119) is 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane.
What is the SMILES notation for 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane?
The canonical SMILES for 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane is CC.CC.Cc1nc(NCCN2CCOCC2)sc1C.
What is the InChIKey of 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane?
The InChIKey is QFFDLXPZPGKQFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS.2C2H6/c1-9-10(2)16-11(13-9)12-3-4-14-5-7-15-8-6-14;2*1-2/h3-8H2,1-2H3,(H,12,13);2*1-2H3.
What are the key properties of 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane?
4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane has a molecular weight of 301.50 g/mol, XLogP of 3.56, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-N-(2-morpholin-4-ylethyl)-1,3-thiazol-2-amine;ethane is sourced from PubChem (CID 142273119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).