C8H18N2O3S2 — CID 63290273
3-[3-methoxypropylsulfonyl(methyl)amino]propanethioamide (PubChem CID 63290273) has the molecular formula C8H18N2O3S2 and a molecular weight of 254.38 g/mol. Its IUPAC name is 3-[3-methoxypropylsulfonyl(methyl)amino]propanethioamide.
| Compound Name | 3-[3-methoxypropylsulfonyl(methyl)amino]propanethioamide |
|---|---|
| PubChem CID | 63290273 |
| Molecular Formula | C8H18N2O3S2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 3-[3-methoxypropylsulfonyl(methyl)amino]propanethioamide |
| SMILES | COCCCS(=O)(=O)N(C)CCC(N)=S |
| InChI | InChI=1S/C8H18N2O3S2/c1-10(5-4-8(9)14)15(11,12)7-3-6-13-2/h3-7H2,1-2H3,(H2,9,14) |
| InChIKey | PZYRXVPCPNFENP-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|