C11H17N3O2S2 — CID 60892675
3-[methyl(2-pyridin-4-ylethylsulfonyl)amino]propanethioamide (PubChem CID 60892675) has the molecular formula C11H17N3O2S2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-[methyl(2-pyridin-4-ylethylsulfonyl)amino]propanethioamide.
| Compound Name | 3-[methyl(2-pyridin-4-ylethylsulfonyl)amino]propanethioamide |
|---|---|
| PubChem CID | 60892675 |
| Molecular Formula | C11H17N3O2S2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 3-[methyl(2-pyridin-4-ylethylsulfonyl)amino]propanethioamide |
| SMILES | CN(CCC(N)=S)S(=O)(=O)CCc1ccncc1 |
| InChI | InChI=1S/C11H17N3O2S2/c1-14(8-4-11(12)17)18(15,16)9-5-10-2-6-13-7-3-10/h2-3,6-7H,4-5,8-9H2,1H3,(H2,12,17) |
| InChIKey | DGHJYHAWANJZJU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|