C12H19ClN2O3S — CID 63400752
N-(2-chloro-3-methoxypropyl)-N-methyl-2-pyridin-4-ylethanesulfonamide (PubChem CID 63400752) has the molecular formula C12H19ClN2O3S and a molecular weight of 306.81 g/mol. Its IUPAC name is N-(2-chloro-3-methoxypropyl)-N-methyl-2-pyridin-4-ylethanesulfonamide.
| Compound Name | N-(2-chloro-3-methoxypropyl)-N-methyl-2-pyridin-4-ylethanesulfonamide |
|---|---|
| PubChem CID | 63400752 |
| Molecular Formula | C12H19ClN2O3S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | N-(2-chloro-3-methoxypropyl)-N-methyl-2-pyridin-4-ylethanesulfonamide |
| SMILES | COCC(Cl)CN(C)S(=O)(=O)CCc1ccncc1 |
| InChI | InChI=1S/C12H19ClN2O3S/c1-15(9-12(13)10-18-2)19(16,17)8-5-11-3-6-14-7-4-11/h3-4,6-7,12H,5,8-10H2,1-2H3 |
| InChIKey | UPNAFBFLFPAORU-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|