C14H28F3NO7 — CID 175688444
2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;2,2,2-trifluoroacetic acid (PubChem CID 175688444) has the molecular formula C14H28F3NO7 and a molecular weight of 379.37 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 175688444 |
| Molecular Formula | C14H28F3NO7 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 2-[2-[2-[2-[2-(dimethylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethanol;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CCOCCOCCOCCOCCO.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H27NO5.C2HF3O2/c1-13(2)3-5-15-7-9-17-11-12-18-10-8-16-6-4-14;3-2(4,5)1(6)7/h14H,3-12H2,1-2H3;(H,6,7) |
| InChIKey | UDGITHQKIJMBHR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|