C7H18N2O3 — CID 87109457
2-[2-[2-[amino(methyl)amino]ethoxy]ethoxy]ethanol (PubChem CID 87109457) has the molecular formula C7H18N2O3 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-[2-[2-[amino(methyl)amino]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[amino(methyl)amino]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 87109457 |
| Molecular Formula | C7H18N2O3 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.13 |
| IUPAC Name | 2-[2-[2-[amino(methyl)amino]ethoxy]ethoxy]ethanol |
| SMILES | CN(N)CCOCCOCCO |
| InChI | InChI=1S/C7H18N2O3/c1-9(8)2-4-11-6-7-12-5-3-10/h10H,2-8H2,1H3 |
| InChIKey | VOWSNPSSESZMJH-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|