C10H23NO4 — CID 123237316
1-[ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol (PubChem CID 123237316) has the molecular formula C10H23NO4 and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-[ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol.
| Compound Name | 1-[ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol |
|---|---|
| PubChem CID | 123237316 |
| Molecular Formula | C10H23NO4 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-[ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol |
| SMILES | CCN(CCOCCOCCO)C(C)O |
| InChI | InChI=1S/C10H23NO4/c1-3-11(10(2)13)4-6-14-8-9-15-7-5-12/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | ROOWPLQPGXKTHI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|