C14H31NO6 — CID 90352000
2-[2-(2-ethoxyethoxy)ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol (PubChem CID 90352000) has the molecular formula C14H31NO6 and a molecular weight of 309.40 g/mol. Its IUPAC name is 2-[2-(2-ethoxyethoxy)ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol.
| Compound Name | 2-[2-(2-ethoxyethoxy)ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol |
|---|---|
| PubChem CID | 90352000 |
| Molecular Formula | C14H31NO6 |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 2-[2-(2-ethoxyethoxy)ethyl-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]ethanol |
| SMILES | CCOCCOCCN(CCO)CCOCCOCCO |
| InChI | InChI=1S/C14H31NO6/c1-2-18-11-12-19-8-4-15(3-6-16)5-9-20-13-14-21-10-7-17/h16-17H,2-14H2,1H3 |
| InChIKey | CXLJRKJVPJKQJD-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 80.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|