About 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane
2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane (PubChem CID 22156510) has the molecular formula C10H25NO4
and a molecular weight of 223.31 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane |
| PubChem CID | 22156510 |
| Molecular Formula | C10H25NO4 |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.18 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane |
| SMILES | CCOCC.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C4H10O/c8-4-1-7(2-5-9)3-6-10;1-3-5-4-2/h8-10H,1-6H2;3-4H2,1-2H3 |
| InChIKey | ZUYSPUQITMQCAF-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane (CID 22156510) is 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane is CCOCC.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane?
The InChIKey is ZUYSPUQITMQCAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C4H10O/c8-4-1-7(2-5-9)3-6-10;1-3-5-4-2/h8-10H,1-6H2;3-4H2,1-2H3.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane?
2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane has a molecular weight of 223.31 g/mol, XLogP of -0.69, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;ethoxyethane is sourced from PubChem (CID 22156510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).