About bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid
bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid (PubChem CID 173449988) has the molecular formula C14H37BN2O9
and a molecular weight of 388.27 g/mol. Its IUPAC name is bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid.
Molecular Properties
| Compound Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid |
| PubChem CID | 173449988 |
| Molecular Formula | C14H37BN2O9 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid |
| SMILES | CCOB(O)O.OCCN(CCO)CCO.OCCN(CCO)CCO |
| InChI | InChI=1S/2C6H15NO3.C2H7BO3/c2*8-4-1-7(2-5-9)3-6-10;1-2-6-3(4)5/h2*8-10H,1-6H2;4-5H,2H2,1H3 |
| InChIKey | NGSYEOUDWWFBPX-UHFFFAOYSA-N |
| XLogP | -4.48 |
| TPSA | 177.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | -4.48 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid?
The IUPAC name of bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid (CID 173449988) is bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid.
What is the SMILES notation for bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid?
The canonical SMILES for bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid is CCOB(O)O.OCCN(CCO)CCO.OCCN(CCO)CCO.
What is the InChIKey of bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid?
The InChIKey is NGSYEOUDWWFBPX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H15NO3.C2H7BO3/c2*8-4-1-7(2-5-9)3-6-10;1-2-6-3(4)5/h2*8-10H,1-6H2;4-5H,2H2,1H3.
What are the key properties of bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid?
bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid has a molecular weight of 388.27 g/mol, XLogP of -4.48, 14 rotatable bonds, 8 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[bis(2-hydroxyethyl)amino]ethanol);ethoxyboronic acid is sourced from PubChem (CID 173449988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).