C9H21NO4 — CID 63932330
1-[bis(2-hydroxyethyl)amino]-3-ethoxypropan-2-ol (PubChem CID 63932330) has the molecular formula C9H21NO4 and a molecular weight of 207.27 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-ethoxypropan-2-ol.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 63932330 |
| Molecular Formula | C9H21NO4 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CN(CCO)CCO |
| InChI | InChI=1S/C9H21NO4/c1-2-14-8-9(13)7-10(3-5-11)4-6-12/h9,11-13H,2-8H2,1H3 |
| InChIKey | DZFLSWBZHLUFQQ-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |