C11H26N2O4 — CID 88894374
1-(2-amino-2-methylpropoxy)-3-[bis(2-hydroxyethyl)amino]propan-2-ol (PubChem CID 88894374) has the molecular formula C11H26N2O4 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2-amino-2-methylpropoxy)-3-[bis(2-hydroxyethyl)amino]propan-2-ol.
| Compound Name | 1-(2-amino-2-methylpropoxy)-3-[bis(2-hydroxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 88894374 |
| Molecular Formula | C11H26N2O4 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1-(2-amino-2-methylpropoxy)-3-[bis(2-hydroxyethyl)amino]propan-2-ol |
| SMILES | CC(C)(N)COCC(O)CN(CCO)CCO |
| InChI | InChI=1S/C11H26N2O4/c1-11(2,12)9-17-8-10(16)7-13(3-5-14)4-6-15/h10,14-16H,3-9,12H2,1-2H3 |
| InChIKey | QWVCKDGOVNRRFI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |