C22H43NO8 — CID 88981124
1-[bis(2-hydroxyethyl)amino]-3-[2-(but-3-enoxymethyl)-2-[2-(ethenoxymethoxy)ethoxymethyl]butoxy]propan-2-ol (PubChem CID 88981124) has the molecular formula C22H43NO8 and a molecular weight of 449.59 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-[2-(but-3-enoxymethyl)-2-[2-(ethenoxymethoxy)ethoxymethyl]butoxy]propan-2-ol.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-[2-(but-3-enoxymethyl)-2-[2-(ethenoxymethoxy)ethoxymethyl]butoxy]propan-2-ol |
|---|---|
| PubChem CID | 88981124 |
| Molecular Formula | C22H43NO8 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-[2-(but-3-enoxymethyl)-2-[2-(ethenoxymethoxy)ethoxymethyl]butoxy]propan-2-ol |
| SMILES | C=CCCOCC(CC)(COCCOCOC=C)COCC(O)CN(CCO)CCO |
| InChI | InChI=1S/C22H43NO8/c1-4-7-12-28-17-22(5-2,18-29-13-14-30-20-27-6-3)19-31-16-21(26)15-23(8-10-24)9-11-25/h4,6,21,24-26H,1,3,5,7-20H2,2H3 |
| InChIKey | XHHRCJBJDNYITJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|