C10H23NO4S — CID 156568864
1-[bis(2-hydroxyethyl)amino]-3-(2-methylsulfanylethoxy)propan-2-ol (PubChem CID 156568864) has the molecular formula C10H23NO4S and a molecular weight of 253.36 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-(2-methylsulfanylethoxy)propan-2-ol.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-(2-methylsulfanylethoxy)propan-2-ol |
|---|---|
| PubChem CID | 156568864 |
| Molecular Formula | C10H23NO4S |
| Molecular Weight | 253.36 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-(2-methylsulfanylethoxy)propan-2-ol |
| SMILES | CSCCOCC(O)CN(CCO)CCO |
| InChI | InChI=1S/C10H23NO4S/c1-16-7-6-15-9-10(14)8-11(2-4-12)3-5-13/h10,12-14H,2-9H2,1H3 |
| InChIKey | HJVPOXXOWJVBOZ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.36 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|