C33H70N2O3S — CID 171073925
1-[2-[ethyl(2-hydroxyethyl)amino]ethyl-hexylamino]-3-[2-(2-hexyldecoxy)ethylsulfanyl]propan-2-ol (PubChem CID 171073925) has the molecular formula C33H70N2O3S and a molecular weight of 575.00 g/mol. Its IUPAC name is 1-[2-[ethyl(2-hydroxyethyl)amino]ethyl-hexylamino]-3-[2-(2-hexyldecoxy)ethylsulfanyl]propan-2-ol.
| Compound Name | 1-[2-[ethyl(2-hydroxyethyl)amino]ethyl-hexylamino]-3-[2-(2-hexyldecoxy)ethylsulfanyl]propan-2-ol |
|---|---|
| PubChem CID | 171073925 |
| Molecular Formula | C33H70N2O3S |
| Molecular Weight | 575.00 g/mol |
| Exact Mass | 574.51 |
| IUPAC Name | 1-[2-[ethyl(2-hydroxyethyl)amino]ethyl-hexylamino]-3-[2-(2-hexyldecoxy)ethylsulfanyl]propan-2-ol |
| SMILES | CCCCCCCCC(CCCCCC)COCCSCC(O)CN(CCCCCC)CCN(CC)CCO |
| InChI | InChI=1S/C33H70N2O3S/c1-5-9-12-15-16-18-21-32(20-17-13-10-6-2)30-38-27-28-39-31-33(37)29-35(22-19-14-11-7-3)24-23-34(8-4)25-26-36/h32-33,36-37H,5-31H2,1-4H3 |
| InChIKey | QTUBZSRXYGJDGJ-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.00 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|