C17H29ClNO5- — CID 53347350
1-[bis(2-hydroxyethyl)amino]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol chloride (PubChem CID 53347350) has the molecular formula C17H29ClNO5- and a molecular weight of 362.87 g/mol. Its IUPAC name is 1-[bis(2-hydroxyethyl)amino]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol chloride.
| Compound Name | 1-[bis(2-hydroxyethyl)amino]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol chloride |
|---|---|
| PubChem CID | 53347350 |
| Molecular Formula | C17H29ClNO5- |
| Molecular Weight | 362.87 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[bis(2-hydroxyethyl)amino]-3-[2-(4-ethylphenoxy)ethoxy]propan-2-ol chloride |
| SMILES | CCc1ccc(OCCOCC(O)CN(CCO)CCO)cc1.[Cl-] |
| InChI | InChI=1S/C17H29NO5.ClH/c1-2-15-3-5-17(6-4-15)23-12-11-22-14-16(21)13-18(7-9-19)8-10-20;/h3-6,16,19-21H,2,7-14H2,1H3;1H/p-1 |
| InChIKey | HJWAWOIBSHYKFP-UHFFFAOYSA-M |
| XLogP | -2.70 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.87 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|