About 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol
1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol (PubChem CID 143268101) has the molecular formula C21H39NO3
and a molecular weight of 353.55 g/mol. Its IUPAC name is 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol.
Molecular Properties
| Compound Name | 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol |
| PubChem CID | 143268101 |
| Molecular Formula | C21H39NO3 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.29 |
| IUPAC Name | 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol |
| SMILES | CCCCCCOc1ccc(CC)cc1.CCCN(CCO)CCO |
| InChI | InChI=1S/C14H22O.C7H17NO2/c1-3-5-6-7-12-15-14-10-8-13(4-2)9-11-14;1-2-3-8(4-6-9)5-7-10/h8-11H,3-7,12H2,1-2H3;9-10H,2-7H2,1H3 |
| InChIKey | SKCJBFIWFVAYLB-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol?
The IUPAC name of 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol (CID 143268101) is 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol.
What is the SMILES notation for 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol?
The canonical SMILES for 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol is CCCCCCOc1ccc(CC)cc1.CCCN(CCO)CCO.
What is the InChIKey of 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol?
The InChIKey is SKCJBFIWFVAYLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22O.C7H17NO2/c1-3-5-6-7-12-15-14-10-8-13(4-2)9-11-14;1-2-3-8(4-6-9)5-7-10/h8-11H,3-7,12H2,1-2H3;9-10H,2-7H2,1H3.
What are the key properties of 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol?
1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol has a molecular weight of 353.55 g/mol, XLogP of 3.89, 13 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-hexoxybenzene;2-[2-hydroxyethyl(propyl)amino]ethanol is sourced from PubChem (CID 143268101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).