C16H31NO4 — CID 124853097
(2R)-1-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[bis(2-hydroxyethyl)amino]propan-2-ol (PubChem CID 124853097) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is (2R)-1-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[bis(2-hydroxyethyl)amino]propan-2-ol.
| Compound Name | (2R)-1-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[bis(2-hydroxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 124853097 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | (2R)-1-[2-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethoxy]-3-[bis(2-hydroxyethyl)amino]propan-2-ol |
| SMILES | OCCN(CCO)C[C@@H](O)COCC[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H31NO4/c18-6-4-17(5-7-19)11-16(20)12-21-8-3-15-10-13-1-2-14(15)9-13/h13-16,18-20H,1-12H2/t13-,14-,15+,16+/m0/s1 |
| InChIKey | IZBYPEFUOYFAOY-CAOSSQGBSA-N |
| XLogP | 0.48 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|