C12H25NO4 — CID 63932802
ethyl 2-[(3-ethoxy-2-hydroxypropyl)-propylamino]acetate (PubChem CID 63932802) has the molecular formula C12H25NO4 and a molecular weight of 247.33 g/mol. Its IUPAC name is ethyl 2-[(3-ethoxy-2-hydroxypropyl)-propylamino]acetate.
| Compound Name | ethyl 2-[(3-ethoxy-2-hydroxypropyl)-propylamino]acetate |
|---|---|
| PubChem CID | 63932802 |
| Molecular Formula | C12H25NO4 |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | ethyl 2-[(3-ethoxy-2-hydroxypropyl)-propylamino]acetate |
| SMILES | CCCN(CC(=O)OCC)CC(O)COCC |
| InChI | InChI=1S/C12H25NO4/c1-4-7-13(9-12(15)17-6-3)8-11(14)10-16-5-2/h11,14H,4-10H2,1-3H3 |
| InChIKey | AVVOVBRLOPUOJM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |