C23H43N3O6 — CID 70043823
tert-butyl N-[2-[3-[(4R)-1-ethyl-2-oxoimidazolidin-4-yl]-1-(1-methoxyethoxymethoxy)propyl]cyclohexyl]carbamate (PubChem CID 70043823) has the molecular formula C23H43N3O6 and a molecular weight of 457.61 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[(4R)-1-ethyl-2-oxoimidazolidin-4-yl]-1-(1-methoxyethoxymethoxy)propyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[(4R)-1-ethyl-2-oxoimidazolidin-4-yl]-1-(1-methoxyethoxymethoxy)propyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 70043823 |
| Molecular Formula | C23H43N3O6 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.32 |
| IUPAC Name | tert-butyl N-[2-[3-[(4R)-1-ethyl-2-oxoimidazolidin-4-yl]-1-(1-methoxyethoxymethoxy)propyl]cyclohexyl]carbamate |
| SMILES | CCN1C[C@@H](CCC(OCOC(C)OC)C2CCCCC2NC(=O)OC(C)(C)C)NC1=O |
| InChI | InChI=1S/C23H43N3O6/c1-7-26-14-17(24-21(26)27)12-13-20(31-15-30-16(2)29-6)18-10-8-9-11-19(18)25-22(28)32-23(3,4)5/h16-20H,7-15H2,1-6H3,(H,24,27)(H,25,28)/t16?,17-,18?,19?,20?/m1/s1 |
| InChIKey | ZZGALVDGFHTSLY-UCWBZLEBSA-N |
| XLogP | 3.62 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|