C16H32N2O4 — CID 107244083
tert-butyl N-[2-(2,2-dimethoxyethylamino)cycloheptyl]carbamate (PubChem CID 107244083) has the molecular formula C16H32N2O4 and a molecular weight of 316.44 g/mol. Its IUPAC name is tert-butyl N-[2-(2,2-dimethoxyethylamino)cycloheptyl]carbamate.
| Compound Name | tert-butyl N-[2-(2,2-dimethoxyethylamino)cycloheptyl]carbamate |
|---|---|
| PubChem CID | 107244083 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | tert-butyl N-[2-(2,2-dimethoxyethylamino)cycloheptyl]carbamate |
| SMILES | COC(CNC1CCCCCC1NC(=O)OC(C)(C)C)OC |
| InChI | InChI=1S/C16H32N2O4/c1-16(2,3)22-15(19)18-13-10-8-6-7-9-12(13)17-11-14(20-4)21-5/h12-14,17H,6-11H2,1-5H3,(H,18,19) |
| InChIKey | WEFJBBLIEAFHBD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|