C22H44N2O7 — CID 86747404
tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-4-hydroxy-3-(1-methoxyethoxymethoxy)-5-[methoxy(methyl)amino]pentan-2-yl]carbamate (PubChem CID 86747404) has the molecular formula C22H44N2O7 and a molecular weight of 448.60 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-4-hydroxy-3-(1-methoxyethoxymethoxy)-5-[methoxy(methyl)amino]pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-4-hydroxy-3-(1-methoxyethoxymethoxy)-5-[methoxy(methyl)amino]pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 86747404 |
| Molecular Formula | C22H44N2O7 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | tert-butyl N-[(2S,3R,4S)-1-cyclohexyl-4-hydroxy-3-(1-methoxyethoxymethoxy)-5-[methoxy(methyl)amino]pentan-2-yl]carbamate |
| SMILES | COC(C)OCO[C@H]([C@H](CC1CCCCC1)NC(=O)OC(C)(C)C)[C@@H](O)CN(C)OC |
| InChI | InChI=1S/C22H44N2O7/c1-16(27-6)29-15-30-20(19(25)14-24(5)28-7)18(13-17-11-9-8-10-12-17)23-21(26)31-22(2,3)4/h16-20,25H,8-15H2,1-7H3,(H,23,26)/t16?,18-,19-,20+/m0/s1 |
| InChIKey | SWJYZBXMXNNGSU-BRLUZMBRSA-N |
| XLogP | 3.06 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|