C22H45N3O5 — CID 70044484
tert-butyl N-[(2S,3R,4S)-4-amino-1-cyclohexyl-5-(ethylamino)-3-(1-methoxyethoxymethoxy)pentan-2-yl]carbamate (PubChem CID 70044484) has the molecular formula C22H45N3O5 and a molecular weight of 431.62 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R,4S)-4-amino-1-cyclohexyl-5-(ethylamino)-3-(1-methoxyethoxymethoxy)pentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R,4S)-4-amino-1-cyclohexyl-5-(ethylamino)-3-(1-methoxyethoxymethoxy)pentan-2-yl]carbamate |
|---|---|
| PubChem CID | 70044484 |
| Molecular Formula | C22H45N3O5 |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | tert-butyl N-[(2S,3R,4S)-4-amino-1-cyclohexyl-5-(ethylamino)-3-(1-methoxyethoxymethoxy)pentan-2-yl]carbamate |
| SMILES | CCNC[C@H](N)[C@@H](OCOC(C)OC)[C@H](CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H45N3O5/c1-7-24-14-18(23)20(29-15-28-16(2)27-6)19(13-17-11-9-8-10-12-17)25-21(26)30-22(3,4)5/h16-20,24H,7-15,23H2,1-6H3,(H,25,26)/t16?,18-,19-,20+/m0/s1 |
| InChIKey | QAPRTPAOPOHBMC-BRLUZMBRSA-N |
| XLogP | 3.14 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|