C18H20ClN3O2 — CID 123691121
methyl 4-[4-[chloro(cyclopropyl)methyl]-2H-benzotriazol-5-yl]cyclohex-3-ene-1-carboxylate (PubChem CID 123691121) has the molecular formula C18H20ClN3O2 and a molecular weight of 345.83 g/mol. Its IUPAC name is methyl 4-[4-[chloro(cyclopropyl)methyl]-2H-benzotriazol-5-yl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 4-[4-[chloro(cyclopropyl)methyl]-2H-benzotriazol-5-yl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 123691121 |
| Molecular Formula | C18H20ClN3O2 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl 4-[4-[chloro(cyclopropyl)methyl]-2H-benzotriazol-5-yl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=C(c2ccc3n[nH]nc3c2C(Cl)C2CC2)CC1 |
| InChI | InChI=1S/C18H20ClN3O2/c1-24-18(23)12-6-2-10(3-7-12)13-8-9-14-17(21-22-20-14)15(13)16(19)11-4-5-11/h2,8-9,11-12,16H,3-7H2,1H3,(H,20,21,22) |
| InChIKey | XUZXDRUDEMZCHE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|