C15H16O3 — CID 45051545
(2Z)-2-[5-(4-methoxyphenyl)cyclohex-2-en-1-ylidene]acetic acid (PubChem CID 45051545) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (2Z)-2-[5-(4-methoxyphenyl)cyclohex-2-en-1-ylidene]acetic acid.
| Compound Name | (2Z)-2-[5-(4-methoxyphenyl)cyclohex-2-en-1-ylidene]acetic acid |
|---|---|
| PubChem CID | 45051545 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (2Z)-2-[5-(4-methoxyphenyl)cyclohex-2-en-1-ylidene]acetic acid |
| SMILES | COc1ccc(C2CC=C/C(=C\C(=O)O)C2)cc1 |
| InChI | InChI=1S/C15H16O3/c1-18-14-7-5-12(6-8-14)13-4-2-3-11(9-13)10-15(16)17/h2-3,5-8,10,13H,4,9H2,1H3,(H,16,17)/b11-10+ |
| InChIKey | XDXXCSHUNDOFKX-ZHACJKMWSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|