C16H16ClNO3 — CID 10063718
methyl (2S,6S)-6-chloro-1-cyano-2-(4-methoxyphenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 10063718) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is methyl (2S,6S)-6-chloro-1-cyano-2-(4-methoxyphenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl (2S,6S)-6-chloro-1-cyano-2-(4-methoxyphenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10063718 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | methyl (2S,6S)-6-chloro-1-cyano-2-(4-methoxyphenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1(C#N)[C@@H](Cl)CC=C[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H16ClNO3/c1-20-12-8-6-11(7-9-12)13-4-3-5-14(17)16(13,10-18)15(19)21-2/h3-4,6-9,13-14H,5H2,1-2H3/t13-,14-,16?/m0/s1 |
| InChIKey | CHVSMTWQTYKKJL-ADTLFGHVSA-N |
| XLogP | 3.03 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|