C16H16N2O2 — CID 823068
(2S,6S)-2-methoxy-6-(4-methoxyphenyl)cyclohex-3-ene-1,1-dicarbonitrile (PubChem CID 823068) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is (2S,6S)-2-methoxy-6-(4-methoxyphenyl)cyclohex-3-ene-1,1-dicarbonitrile.
| Compound Name | (2S,6S)-2-methoxy-6-(4-methoxyphenyl)cyclohex-3-ene-1,1-dicarbonitrile |
|---|---|
| PubChem CID | 823068 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | (2S,6S)-2-methoxy-6-(4-methoxyphenyl)cyclohex-3-ene-1,1-dicarbonitrile |
| SMILES | COc1ccc([C@@H]2CC=C[C@H](OC)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C16H16N2O2/c1-19-13-8-6-12(7-9-13)14-4-3-5-15(20-2)16(14,10-17)11-18/h3,5-9,14-15H,4H2,1-2H3/t14-,15-/m0/s1 |
| InChIKey | CHYXEGYOWCRWJX-GJZGRUSLSA-N |
| XLogP | 2.79 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|