C16H18N2O — CID 46703992
(3S,3aR,7aS)-3-(4-methoxyphenyl)-1,2,3,4,5,7a-hexahydroisoindole-3a-carbonitrile (PubChem CID 46703992) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is (3S,3aR,7aS)-3-(4-methoxyphenyl)-1,2,3,4,5,7a-hexahydroisoindole-3a-carbonitrile.
| Compound Name | (3S,3aR,7aS)-3-(4-methoxyphenyl)-1,2,3,4,5,7a-hexahydroisoindole-3a-carbonitrile |
|---|---|
| PubChem CID | 46703992 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | (3S,3aR,7aS)-3-(4-methoxyphenyl)-1,2,3,4,5,7a-hexahydroisoindole-3a-carbonitrile |
| SMILES | COc1ccc([C@@H]2NC[C@H]3C=CCC[C@@]32C#N)cc1 |
| InChI | InChI=1S/C16H18N2O/c1-19-14-7-5-12(6-8-14)15-16(11-17)9-3-2-4-13(16)10-18-15/h2,4-8,13,15,18H,3,9-10H2,1H3/t13-,15+,16-/m1/s1 |
| InChIKey | BVNFOJGAUOXKMF-VNQPRFMTSA-N |
| XLogP | 2.82 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|