C17H12Cl2F3NO — CID 2177123
trans-(1S,3S)-2,2-dichloro-3-phenyl-N-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide (PubChem CID 2177123) has the molecular formula C17H12Cl2F3NO and a molecular weight of 374.19 g/mol. Its IUPAC name is trans-(1S,3S)-2,2-dichloro-3-phenyl-N-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide.
| Compound Name | trans-(1S,3S)-2,2-dichloro-3-phenyl-N-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 2177123 |
| Molecular Formula | C17H12Cl2F3NO |
| Molecular Weight | 374.19 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | trans-(1S,3S)-2,2-dichloro-3-phenyl-N-[2-(trifluoromethyl)phenyl]cyclopropane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)[C@@H]1[C@@H](c2ccccc2)C1(Cl)Cl |
| InChI | InChI=1S/C17H12Cl2F3NO/c18-16(19)13(10-6-2-1-3-7-10)14(16)15(24)23-12-9-5-4-8-11(12)17(20,21)22/h1-9,13-14H,(H,23,24)/t13-,14+/m1/s1 |
| InChIKey | KURGVKCHBFOSBV-KGLIPLIRSA-N |
| XLogP | 5.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.19 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|