C15H12F3NO4 — CID 99719754
(1S,2S,3R,4R)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 99719754) has the molecular formula C15H12F3NO4 and a molecular weight of 327.26 g/mol. Its IUPAC name is (1S,2S,3R,4R)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2S,3R,4R)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 99719754 |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | (1S,2S,3R,4R)-3-[[2-(trifluoromethyl)phenyl]carbamoyl]-7-oxabicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(Nc1ccccc1C(F)(F)F)[C@@H]1[C@H](C(=O)O)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C15H12F3NO4/c16-15(17,18)7-3-1-2-4-8(7)19-13(20)11-9-5-6-10(23-9)12(11)14(21)22/h1-6,9-12H,(H,19,20)(H,21,22)/t9-,10+,11+,12-/m1/s1 |
| InChIKey | HEQCVKVKKBIQIR-NOOOWODRSA-N |
| XLogP | 2.30 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|