C11H14FNO2 — CID 139641920
[3-(4-fluorophenyl)-4-methyl-1,2-oxazolidin-5-yl]methanol (PubChem CID 139641920) has the molecular formula C11H14FNO2 and a molecular weight of 211.24 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-4-methyl-1,2-oxazolidin-5-yl]methanol.
| Compound Name | [3-(4-fluorophenyl)-4-methyl-1,2-oxazolidin-5-yl]methanol |
|---|---|
| PubChem CID | 139641920 |
| Molecular Formula | C11H14FNO2 |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | [3-(4-fluorophenyl)-4-methyl-1,2-oxazolidin-5-yl]methanol |
| SMILES | CC1C(CO)ONC1c1ccc(F)cc1 |
| InChI | InChI=1S/C11H14FNO2/c1-7-10(6-14)15-13-11(7)8-2-4-9(12)5-3-8/h2-5,7,10-11,13-14H,6H2,1H3 |
| InChIKey | WMTFOHPQZTUPOA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |