About 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane
10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane (PubChem CID 20612041) has the molecular formula C11H19NO2
and a molecular weight of 197.28 g/mol. Its IUPAC name is 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane.
Analyze 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane?
The IUPAC name of 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane (CID 20612041) is 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane.
What is the SMILES notation for 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane?
The canonical SMILES for 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane is CC1CC2OC3CCCN3C2C(C)O1.
What is the InChIKey of 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane?
The InChIKey is IRWSBEOTQLOVJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-7-6-9-11(8(2)13-7)12-5-3-4-10(12)14-9/h7-11H,3-6H2,1-2H3.
What are the key properties of 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane?
10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane has a molecular weight of 197.28 g/mol, XLogP of 1.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,12-dimethyl-7,11-dioxa-2-azatricyclo[6.4.0.02,6]dodecane is sourced from PubChem (CID 20612041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).