C12H21NO — CID 97385072
(2S,3aS,7aS)-6-(cyclopropylmethyl)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine (PubChem CID 97385072) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2S,3aS,7aS)-6-(cyclopropylmethyl)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine.
| Compound Name | (2S,3aS,7aS)-6-(cyclopropylmethyl)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
|---|---|
| PubChem CID | 97385072 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2S,3aS,7aS)-6-(cyclopropylmethyl)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine |
| SMILES | C[C@H]1C[C@@H]2CCN(CC3CC3)C[C@H]2O1 |
| InChI | InChI=1S/C12H21NO/c1-9-6-11-4-5-13(7-10-2-3-10)8-12(11)14-9/h9-12H,2-8H2,1H3/t9-,11-,12+/m0/s1 |
| InChIKey | UKCPWFRQZFUYFX-ZMLRMANQSA-N |
| XLogP | 1.90 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |