C10H20N2O — CID 82406454
2,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-amine (PubChem CID 82406454) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-amine.
| Compound Name | 2,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-amine |
|---|---|
| PubChem CID | 82406454 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2,6-dimethyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-4-amine |
| SMILES | CC1CC(N)C2CN(C)CCC2O1 |
| InChI | InChI=1S/C10H20N2O/c1-7-5-9(11)8-6-12(2)4-3-10(8)13-7/h7-10H,3-6,11H2,1-2H3 |
| InChIKey | VGPOARYDTKSVHL-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |