About 1-methylpyrrolidin-3-amine;sulfanol
1-methylpyrrolidin-3-amine;sulfanol (PubChem CID 143564913) has the molecular formula C5H14N2OS
and a molecular weight of 150.25 g/mol. Its IUPAC name is 1-methylpyrrolidin-3-amine;sulfanol.
Molecular Properties
| Compound Name | 1-methylpyrrolidin-3-amine;sulfanol |
| PubChem CID | 143564913 |
| Molecular Formula | C5H14N2OS |
| Molecular Weight | 150.25 g/mol |
| Exact Mass | 150.08 |
| IUPAC Name | 1-methylpyrrolidin-3-amine;sulfanol |
| SMILES | CN1CCC(N)C1.OS |
| InChI | InChI=1S/C5H12N2.H2OS/c1-7-3-2-5(6)4-7;1-2/h5H,2-4,6H2,1H3;1-2H |
| InChIKey | UNTCUANRTQTTRZ-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrrolidin-3-amine;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrrolidin-3-amine;sulfanol?
The IUPAC name of 1-methylpyrrolidin-3-amine;sulfanol (CID 143564913) is 1-methylpyrrolidin-3-amine;sulfanol.
What is the SMILES notation for 1-methylpyrrolidin-3-amine;sulfanol?
The canonical SMILES for 1-methylpyrrolidin-3-amine;sulfanol is CN1CCC(N)C1.OS.
What is the InChIKey of 1-methylpyrrolidin-3-amine;sulfanol?
The InChIKey is UNTCUANRTQTTRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2.H2OS/c1-7-3-2-5(6)4-7;1-2/h5H,2-4,6H2,1H3;1-2H.
What are the key properties of 1-methylpyrrolidin-3-amine;sulfanol?
1-methylpyrrolidin-3-amine;sulfanol has a molecular weight of 150.25 g/mol, XLogP of 0.04, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrrolidin-3-amine;sulfanol is sourced from PubChem (CID 143564913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).