C7H18Cl2N2 — CID 53407082
1,3-dimethylpiperidin-4-amine;dihydrochloride (PubChem CID 53407082) has the molecular formula C7H18Cl2N2 and a molecular weight of 201.14 g/mol. Its IUPAC name is 1,3-dimethylpiperidin-4-amine;dihydrochloride.
| Compound Name | 1,3-dimethylpiperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 53407082 |
| Molecular Formula | C7H18Cl2N2 |
| Molecular Weight | 201.14 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1,3-dimethylpiperidin-4-amine;dihydrochloride |
| SMILES | CC1CN(C)CCC1N.Cl.Cl |
| InChI | InChI=1S/C7H16N2.2ClH/c1-6-5-9(2)4-3-7(6)8;;/h6-7H,3-5,8H2,1-2H3;2*1H |
| InChIKey | YPGNKRYLHNGLKX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |