About (4R)-1-methylpiperidine-3,4-diamine
(4R)-1-methylpiperidine-3,4-diamine (PubChem CID 145189555) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is (4R)-1-methylpiperidine-3,4-diamine.
Molecular Properties
| Compound Name | (4R)-1-methylpiperidine-3,4-diamine |
| PubChem CID | 145189555 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | (4R)-1-methylpiperidine-3,4-diamine |
| SMILES | CN1CC[C@@H](N)C(N)C1 |
| InChI | InChI=1S/C6H15N3/c1-9-3-2-5(7)6(8)4-9/h5-6H,2-4,7-8H2,1H3/t5-,6?/m1/s1 |
| InChIKey | YZGPFBZRPUYRRO-LWOQYNTDSA-N |
| XLogP | -1.02 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-1-methylpiperidine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-1-methylpiperidine-3,4-diamine?
The IUPAC name of (4R)-1-methylpiperidine-3,4-diamine (CID 145189555) is (4R)-1-methylpiperidine-3,4-diamine.
What is the SMILES notation for (4R)-1-methylpiperidine-3,4-diamine?
The canonical SMILES for (4R)-1-methylpiperidine-3,4-diamine is CN1CC[C@@H](N)C(N)C1.
What is the InChIKey of (4R)-1-methylpiperidine-3,4-diamine?
The InChIKey is YZGPFBZRPUYRRO-LWOQYNTDSA-N. The full InChI is InChI=1S/C6H15N3/c1-9-3-2-5(7)6(8)4-9/h5-6H,2-4,7-8H2,1H3/t5-,6?/m1/s1.
What are the key properties of (4R)-1-methylpiperidine-3,4-diamine?
(4R)-1-methylpiperidine-3,4-diamine has a molecular weight of 129.21 g/mol, XLogP of -1.02, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-1-methylpiperidine-3,4-diamine is sourced from PubChem (CID 145189555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).