C7H13F3N2 — CID 166815435
(3R,4R)-1-methyl-4-(trifluoromethyl)piperidin-3-amine (PubChem CID 166815435) has the molecular formula C7H13F3N2 and a molecular weight of 182.19 g/mol. Its IUPAC name is (3R,4R)-1-methyl-4-(trifluoromethyl)piperidin-3-amine.
| Compound Name | (3R,4R)-1-methyl-4-(trifluoromethyl)piperidin-3-amine |
|---|---|
| PubChem CID | 166815435 |
| Molecular Formula | C7H13F3N2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.10 |
| IUPAC Name | (3R,4R)-1-methyl-4-(trifluoromethyl)piperidin-3-amine |
| SMILES | CN1CC[C@@H](C(F)(F)F)[C@@H](N)C1 |
| InChI | InChI=1S/C7H13F3N2/c1-12-3-2-5(6(11)4-12)7(8,9)10/h5-6H,2-4,11H2,1H3/t5-,6+/m1/s1 |
| InChIKey | IJOYAKMYXSNWDR-RITPCOANSA-N |
| XLogP | 0.83 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |