C8H20N2O — CID 145443394
(3S,4R)-4-amino-1-methylpiperidin-3-ol;ethane (PubChem CID 145443394) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is (3S,4R)-4-amino-1-methylpiperidin-3-ol;ethane.
| Compound Name | (3S,4R)-4-amino-1-methylpiperidin-3-ol;ethane |
|---|---|
| PubChem CID | 145443394 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | (3S,4R)-4-amino-1-methylpiperidin-3-ol;ethane |
| SMILES | CC.CN1CC[C@@H](N)[C@@H](O)C1 |
| InChI | InChI=1S/C6H14N2O.C2H6/c1-8-3-2-5(7)6(9)4-8;1-2/h5-6,9H,2-4,7H2,1H3;1-2H3/t5-,6+;/m1./s1 |
| InChIKey | IECFYMHVOUKQND-IBTYICNHSA-N |
| XLogP | 0.04 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |