C7H16N2O — CID 176703641
(4R,5S)-5-amino-1-methylazepan-4-ol (PubChem CID 176703641) has the molecular formula C7H16N2O and a molecular weight of 144.22 g/mol. Its IUPAC name is (4R,5S)-5-amino-1-methylazepan-4-ol.
| Compound Name | (4R,5S)-5-amino-1-methylazepan-4-ol |
|---|---|
| PubChem CID | 176703641 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | (4R,5S)-5-amino-1-methylazepan-4-ol |
| SMILES | CN1CC[C@@H](O)[C@@H](N)CC1 |
| InChI | InChI=1S/C7H16N2O/c1-9-4-2-6(8)7(10)3-5-9/h6-7,10H,2-5,8H2,1H3/t6-,7+/m0/s1 |
| InChIKey | CAEQFWSXWXZDPA-NKWVEPMBSA-N |
| XLogP | -0.60 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |