C6H11NO — CID 124845520
(1S,6S)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane (PubChem CID 124845520) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (1S,6S)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane.
| Compound Name | (1S,6S)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 124845520 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (1S,6S)-3-methyl-7-oxa-3-azabicyclo[4.1.0]heptane |
| SMILES | CN1CC[C@@H]2O[C@H]2C1 |
| InChI | InChI=1S/C6H11NO/c1-7-3-2-5-6(4-7)8-5/h5-6H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | NESUSYSTQOTTLQ-WDSKDSINSA-N |
| XLogP | 0.09 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|