C7H14N2O — CID 163573249
2,5-dimethyl-8-oxa-2,5-diazabicyclo[5.1.0]octane (PubChem CID 163573249) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is 2,5-dimethyl-8-oxa-2,5-diazabicyclo[5.1.0]octane.
| Compound Name | 2,5-dimethyl-8-oxa-2,5-diazabicyclo[5.1.0]octane |
|---|---|
| PubChem CID | 163573249 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | 2,5-dimethyl-8-oxa-2,5-diazabicyclo[5.1.0]octane |
| SMILES | CN1CCN(C)C2OC2C1 |
| InChI | InChI=1S/C7H14N2O/c1-8-3-4-9(2)7-6(5-8)10-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | GBFDYLHFSYLTOW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 19.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|