About (2R)-2-cyclobutyl-1,4-dimethylpiperazine
(2R)-2-cyclobutyl-1,4-dimethylpiperazine (PubChem CID 170608079) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is (2R)-2-cyclobutyl-1,4-dimethylpiperazine.
Molecular Properties
| Compound Name | (2R)-2-cyclobutyl-1,4-dimethylpiperazine |
| PubChem CID | 170608079 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (2R)-2-cyclobutyl-1,4-dimethylpiperazine |
| SMILES | CN1CCN(C)[C@H](C2CCC2)C1 |
| InChI | InChI=1S/C10H20N2/c1-11-6-7-12(2)10(8-11)9-4-3-5-9/h9-10H,3-8H2,1-2H3/t10-/m0/s1 |
| InChIKey | SKEICJRZWGXLNA-JTQLQIEISA-N |
| XLogP | 1.03 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-2-cyclobutyl-1,4-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-cyclobutyl-1,4-dimethylpiperazine?
The IUPAC name of (2R)-2-cyclobutyl-1,4-dimethylpiperazine (CID 170608079) is (2R)-2-cyclobutyl-1,4-dimethylpiperazine.
What is the SMILES notation for (2R)-2-cyclobutyl-1,4-dimethylpiperazine?
The canonical SMILES for (2R)-2-cyclobutyl-1,4-dimethylpiperazine is CN1CCN(C)[C@H](C2CCC2)C1.
What is the InChIKey of (2R)-2-cyclobutyl-1,4-dimethylpiperazine?
The InChIKey is SKEICJRZWGXLNA-JTQLQIEISA-N. The full InChI is InChI=1S/C10H20N2/c1-11-6-7-12(2)10(8-11)9-4-3-5-9/h9-10H,3-8H2,1-2H3/t10-/m0/s1.
What are the key properties of (2R)-2-cyclobutyl-1,4-dimethylpiperazine?
(2R)-2-cyclobutyl-1,4-dimethylpiperazine has a molecular weight of 168.28 g/mol, XLogP of 1.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-cyclobutyl-1,4-dimethylpiperazine is sourced from PubChem (CID 170608079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).