C8H15BrN2 — CID 89020740
(4aS,7aS)-6-bromo-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 89020740) has the molecular formula C8H15BrN2 and a molecular weight of 219.13 g/mol. Its IUPAC name is (4aS,7aS)-6-bromo-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4aS,7aS)-6-bromo-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 89020740 |
| Molecular Formula | C8H15BrN2 |
| Molecular Weight | 219.13 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (4aS,7aS)-6-bromo-1-methyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | CN1CCC[C@H]2CN(Br)C[C@H]21 |
| InChI | InChI=1S/C8H15BrN2/c1-10-4-2-3-7-5-11(9)6-8(7)10/h7-8H,2-6H2,1H3/t7-,8+/m0/s1 |
| InChIKey | FNALTCZOUFUXRG-JGVFFNPUSA-N |
| XLogP | 1.32 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.13 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|