C9H18N2 — CID 59704451
(4aS,7aS)-6-methanidyl-1-methyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium (PubChem CID 59704451) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (4aS,7aS)-6-methanidyl-1-methyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium.
| Compound Name | (4aS,7aS)-6-methanidyl-1-methyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium |
|---|---|
| PubChem CID | 59704451 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4aS,7aS)-6-methanidyl-1-methyl-2,3,4,4a,5,6,7,7a-octahydropyrrolo[3,4-b]pyridin-6-ium |
| SMILES | [CH2-][NH+]1C[C@@H]2CCCN(C)[C@@H]2C1 |
| InChI | InChI=1S/C9H18N2/c1-10-6-8-4-3-5-11(2)9(8)7-10/h8-10H,1,3-7H2,2H3/t8-,9+/m0/s1 |
| InChIKey | FSZAZOVYALPLEG-DTWKUNHWSA-N |
| XLogP | -0.61 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|