C10H21N5 — CID 81199645
N'-amino-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide (PubChem CID 81199645) has the molecular formula C10H21N5 and a molecular weight of 211.31 g/mol. Its IUPAC name is N'-amino-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide.
| Compound Name | N'-amino-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide |
|---|---|
| PubChem CID | 81199645 |
| Molecular Formula | C10H21N5 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.18 |
| IUPAC Name | N'-amino-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboximidamide |
| SMILES | CN1CCCC2CN(C(N)=NN)CCC21 |
| InChI | InChI=1S/C10H21N5/c1-14-5-2-3-8-7-15(10(11)13-12)6-4-9(8)14/h8-9H,2-7,12H2,1H3,(H2,11,13) |
| InChIKey | RJQKGBPCNMFZPQ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|